6-(methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid - Names and Identifiers
Name | (1S,2R)-1-methyl cis-1,2,3,6-tetrahydro-phthalate
|
Synonyms | 6-MCCA (1S,2R)-1-METHYL CIS-1,2,3,6-TETRAHYDROPHTHALATE (1S,2R)-1-methyl cis-1,2,3,6-tetrahydro-phthalate 6-Methoxycarbonyl-3-cyclohexene-1-carboxylic acid 6-methoxycarbonyl-3-cyclohexene-1-carboxylic acid 6-(methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid 6-(Methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid 1-METHYL (1S,2R)-(+)-CIS-1,2,3,6-TETRAHYDROPHTHALATE (1S,2R)-1-METHYL CIS-4-CYCLOHEXENE-1,2-DICARBOXYLATE (1R,6S)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid (1R,6S)-6-(Methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid (1S,2R)-4-Cyclohexene-1,2-dicarboxylic acid monomethyl ester (1S,2R)-cis-Cyclohex-4-ene-1,2-dicarboxylic 1-monomethyl ester (1R,6S)-cis-6-(Methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid (1S,2R)-CIS-4-CYCLOHEXENE-1,2-DICARBOXYLIC ACID 1-MONOMETHYL ESTER (1S,2R)-cis-4-Cyclohexene-1,2-dicarboxylic acid 1-monomethylester, (1S,2R)-1-Methyl cis-4-cyclohexene-1,2-dicarboxylate
|
CAS | 88335-93-7
|
InChI | InChI=1/C9H12O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-3,6-7H,4-5H2,1H3,(H,10,11)/t6-,7+/m1/s1 |
6-(methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid - Physico-chemical Properties
Molecular Formula | C9H12O4
|
Molar Mass | 184.19 |
Density | 1.231 |
Melting Point | 65-67°C(lit.) |
Boling Point | 306.5±42.0 °C(Predicted) |
Specific Rotation(α) | 13 º (c=1, acetone) |
Flash Point | 121°C |
Water Solubility | Insoluble in water. |
Vapor Presure | 0mmHg at 25°C |
BRN | 5262096 |
pKa | 4.26±0.40(Predicted) |
Storage Condition | 2-8℃ |
Refractive Index | 1.504 |
MDL | MFCD00075490 |
6-(methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid - Risk and Safety
6-(methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid - Introduction
(1S, 2R)-4-cyclohexene-1, 6-dicarboxylic acid monomethyl ester, chemical formula C9H12O4, molecular weight 184.19g/mol.
Properties:(1S, 2R)-4-cyclohexene-1, 6-dicarboxylic acid monomethyl ester is a colorless or light yellow liquid with a special fragrance at room temperature. It can be dissolved in certain organic solvents, such as ethanol and ether.
Purpose:(1S, 2R)-4-cyclohexene-1, 6-dicarboxylic acid monomethyl ester is an important chemical intermediate, widely used in medicine, pesticide, spice and dye industry. It can be used to synthesize a variety of drugs and bioactive molecules, such as cyclazolone antibiotics, anticancer drugs, etc.
Preparation:(1S, 2R)-4-cyclohexene-1, 6-dicarboxylic acid monomethyl ester is generally prepared by reacting (1S, 2R)-4-cyclohexene-1, 2,3, 6-tetra-carboxylic acid methyl ester with a suitable reducing agent. Specifically, methyl (1S, 2R)-4-cyclohexene-1, 2,3, 6-tetra-carboxylate is reacted with a reducing agent such as sodium borohydride at an appropriate temperature to obtain monomethyl (1S, 2R)-4-cyclohexene-1, 6-dicarboxylate.
Safety information:(1S, 2R)-4-cyclohexene-1, 6-dicarboxylic acid monomethyl ester is relatively safe under general operating conditions. But it can be irritating to the eyes and skin, and can be potentially chronic toxic to humans. Therefore, when using and handling, appropriate personal protective measures should be taken, such as wearing gloves, goggles and protective clothing. At the same time, the relevant laws and regulations should be followed and the correct storage and handling of the chemical should be ensured.
Last Update:2024-04-09 21:11:58